C26H24IN3O5 — CID 23807902
[(E,1R,2R)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate (PubChem CID 23807902) has the molecular formula C26H24IN3O5 and a molecular weight of 585.40 g/mol. Its IUPAC name is [(E,1R,2R)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1R,2R)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23807902 |
| Molecular Formula | C26H24IN3O5 |
| Molecular Weight | 585.40 g/mol |
| Exact Mass | 585.08 |
| IUPAC Name | [(E,1R,2R)-5-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate |
| SMILES | C[C@H](/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)NC(=O)c1ccccc1)c1cc(I)ccc1O |
| InChI | InChI=1S/C26H24IN3O5/c1-16(11-14-23(32)29-21-10-6-5-9-20(21)28)24(19-15-18(27)12-13-22(19)31)35-26(34)30-25(33)17-7-3-2-4-8-17/h2-16,24,31H,28H2,1H3,(H,29,32)(H,30,33,34)/b14-11+/t16-,24-/m1/s1 |
| InChIKey | PULBHRJUWJZHQF-PHUBOHLVSA-N |
| XLogP | 5.02 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|