C29H30IN3O6 — CID 23864802
[(E,1R,2R)-7-(2-aminoanilino)-2-ethoxy-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-benzoylcarbamate (PubChem CID 23864802) has the molecular formula C29H30IN3O6 and a molecular weight of 643.48 g/mol. Its IUPAC name is [(E,1R,2R)-7-(2-aminoanilino)-2-ethoxy-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1R,2R)-7-(2-aminoanilino)-2-ethoxy-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23864802 |
| Molecular Formula | C29H30IN3O6 |
| Molecular Weight | 643.48 g/mol |
| Exact Mass | 643.12 |
| IUPAC Name | [(E,1R,2R)-7-(2-aminoanilino)-2-ethoxy-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-benzoylcarbamate |
| SMILES | CCO[C@H](CC/C=C/C(=O)Nc1ccccc1N)[C@H](OC(=O)NC(=O)c1ccccc1)c1cc(I)ccc1O |
| InChI | InChI=1S/C29H30IN3O6/c1-2-38-25(14-8-9-15-26(35)32-23-13-7-6-12-22(23)31)27(21-18-20(30)16-17-24(21)34)39-29(37)33-28(36)19-10-4-3-5-11-19/h3-7,9-13,15-18,25,27,34H,2,8,14,31H2,1H3,(H,32,35)(H,33,36,37)/b15-9+/t25-,27-/m1/s1 |
| InChIKey | JVXOFEHLWUWACG-RQEPPXPNSA-N |
| XLogP | 5.57 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.48 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|