C28H29Br2N3O5 — CID 23836449
[(E,1S,2S)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-ethoxy-7-oxohept-5-enyl] N-phenylcarbamate (PubChem CID 23836449) has the molecular formula C28H29Br2N3O5 and a molecular weight of 647.36 g/mol. Its IUPAC name is [(E,1S,2S)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-ethoxy-7-oxohept-5-enyl] N-phenylcarbamate.
| Compound Name | [(E,1S,2S)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-ethoxy-7-oxohept-5-enyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 23836449 |
| Molecular Formula | C28H29Br2N3O5 |
| Molecular Weight | 647.36 g/mol |
| Exact Mass | 645.05 |
| IUPAC Name | [(E,1S,2S)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-ethoxy-7-oxohept-5-enyl] N-phenylcarbamate |
| SMILES | CCO[C@@H](CC/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)Nc1ccccc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C28H29Br2N3O5/c1-2-37-24(14-8-9-15-25(34)33-23-13-7-6-12-22(23)31)27(20-16-18(29)17-21(30)26(20)35)38-28(36)32-19-10-4-3-5-11-19/h3-7,9-13,15-17,24,27,35H,2,8,14,31H2,1H3,(H,32,36)(H,33,34)/b15-9+/t24-,27-/m0/s1 |
| InChIKey | PEMNRBYAZQVHOW-ZSKQNPCESA-N |
| XLogP | 7.17 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.36 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|