C27H27Br2N3O4 — CID 23807774
[(E,1R)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-7-oxohept-5-enyl] N-(4-methylphenyl)carbamate (PubChem CID 23807774) has the molecular formula C27H27Br2N3O4 and a molecular weight of 617.34 g/mol. Its IUPAC name is [(E,1R)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-7-oxohept-5-enyl] N-(4-methylphenyl)carbamate.
| Compound Name | [(E,1R)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-7-oxohept-5-enyl] N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 23807774 |
| Molecular Formula | C27H27Br2N3O4 |
| Molecular Weight | 617.34 g/mol |
| Exact Mass | 615.04 |
| IUPAC Name | [(E,1R)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-7-oxohept-5-enyl] N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)O[C@H](CCC/C=C/C(=O)Nc2ccccc2N)c2cc(Br)cc(Br)c2O)cc1 |
| InChI | InChI=1S/C27H27Br2N3O4/c1-17-11-13-19(14-12-17)31-27(35)36-24(20-15-18(28)16-21(29)26(20)34)9-3-2-4-10-25(33)32-23-8-6-5-7-22(23)30/h4-8,10-16,24,34H,2-3,9,30H2,1H3,(H,31,35)(H,32,33)/b10-4+/t24-/m1/s1 |
| InChIKey | MJJCUKHLFHYBAG-RPXNDYEYSA-N |
| XLogP | 7.46 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.34 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|