C26H24Br3N3O5 — CID 23948374
[(E,1R,2R)-5-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-ethoxy-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate (PubChem CID 23948374) has the molecular formula C26H24Br3N3O5 and a molecular weight of 698.21 g/mol. Its IUPAC name is [(E,1R,2R)-5-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-ethoxy-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate.
| Compound Name | [(E,1R,2R)-5-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-ethoxy-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 23948374 |
| Molecular Formula | C26H24Br3N3O5 |
| Molecular Weight | 698.21 g/mol |
| Exact Mass | 694.93 |
| IUPAC Name | [(E,1R,2R)-5-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-ethoxy-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate |
| SMILES | CCO[C@H](/C=C/C(=O)Nc1ccccc1N)[C@H](OC(=O)Nc1ccc(Br)cc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C26H24Br3N3O5/c1-2-36-22(11-12-23(33)32-21-6-4-3-5-20(21)30)25(18-13-16(28)14-19(29)24(18)34)37-26(35)31-17-9-7-15(27)8-10-17/h3-14,22,25,34H,2,30H2,1H3,(H,31,35)(H,32,33)/b12-11+/t22-,25-/m1/s1 |
| InChIKey | AMXMNDKGKRDVON-BQQFXCQDSA-N |
| XLogP | 7.15 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.21 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|