C26H23Br2N3O6 — CID 23778770
[(E,1R,2S)-5-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate (PubChem CID 23778770) has the molecular formula C26H23Br2N3O6 and a molecular weight of 633.29 g/mol. Its IUPAC name is [(E,1R,2S)-5-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate.
| Compound Name | [(E,1R,2S)-5-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 23778770 |
| Molecular Formula | C26H23Br2N3O6 |
| Molecular Weight | 633.29 g/mol |
| Exact Mass | 631.00 |
| IUPAC Name | [(E,1R,2S)-5-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
| SMILES | C[C@@H](/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)Nc1ccc2c(c1)OCO2)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C26H23Br2N3O6/c1-14(6-9-23(32)31-20-5-3-2-4-19(20)29)25(17-10-15(27)11-18(28)24(17)33)37-26(34)30-16-7-8-21-22(12-16)36-13-35-21/h2-12,14,25,33H,13,29H2,1H3,(H,30,34)(H,31,32)/b9-6+/t14-,25+/m0/s1 |
| InChIKey | JQBGNYCCFCVHMP-RUYTWCCZSA-N |
| XLogP | 6.35 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.29 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|