C35H29N3O7 — CID 23892424
[(E,1R,2R)-5-(2-aminoanilino)-1-(4-hydroxynaphthalen-1-yl)-5-oxo-2-phenoxypent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate (PubChem CID 23892424) has the molecular formula C35H29N3O7 and a molecular weight of 603.63 g/mol. Its IUPAC name is [(E,1R,2R)-5-(2-aminoanilino)-1-(4-hydroxynaphthalen-1-yl)-5-oxo-2-phenoxypent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate.
| Compound Name | [(E,1R,2R)-5-(2-aminoanilino)-1-(4-hydroxynaphthalen-1-yl)-5-oxo-2-phenoxypent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 23892424 |
| Molecular Formula | C35H29N3O7 |
| Molecular Weight | 603.63 g/mol |
| Exact Mass | 603.20 |
| IUPAC Name | [(E,1R,2R)-5-(2-aminoanilino)-1-(4-hydroxynaphthalen-1-yl)-5-oxo-2-phenoxypent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
| SMILES | Nc1ccccc1NC(=O)/C=C/[C@@H](Oc1ccccc1)[C@H](OC(=O)Nc1ccc2c(c1)OCO2)c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C35H29N3O7/c36-27-12-6-7-13-28(27)38-33(40)19-18-31(44-23-8-2-1-3-9-23)34(26-15-16-29(39)25-11-5-4-10-24(25)26)45-35(41)37-22-14-17-30-32(20-22)43-21-42-30/h1-20,31,34,39H,21,36H2,(H,37,41)(H,38,40)/b19-18+/t31-,34-/m1/s1 |
| InChIKey | COIBNEJCTDSEAN-JLSPYTHDSA-N |
| XLogP | 6.79 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.63 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|