C28H29N3O7 — CID 23920925
[(E,1S,2R)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate (PubChem CID 23920925) has the molecular formula C28H29N3O7 and a molecular weight of 519.55 g/mol. Its IUPAC name is [(E,1S,2R)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate.
| Compound Name | [(E,1S,2R)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 23920925 |
| Molecular Formula | C28H29N3O7 |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | [(E,1S,2R)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
| SMILES | C[C@H](/C=C/C(=O)Nc1ccccc1N)[C@H](OC(=O)Nc1ccc2c(c1)OCO2)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C28H29N3O7/c1-18(9-12-26(33)31-23-8-3-2-7-22(23)29)27(19-5-4-6-21(15-19)35-14-13-32)38-28(34)30-20-10-11-24-25(16-20)37-17-36-24/h2-12,15-16,18,27,32H,13-14,17,29H2,1H3,(H,30,34)(H,31,33)/b12-9+/t18-,27+/m1/s1 |
| InChIKey | XIYCGMCFBSPXFP-INHKVLSFSA-N |
| XLogP | 4.49 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|