C27H28BrN3O5 — CID 23779131
[(E,1S,2S)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate (PubChem CID 23779131) has the molecular formula C27H28BrN3O5 and a molecular weight of 554.44 g/mol. Its IUPAC name is [(E,1S,2S)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate.
| Compound Name | [(E,1S,2S)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 23779131 |
| Molecular Formula | C27H28BrN3O5 |
| Molecular Weight | 554.44 g/mol |
| Exact Mass | 553.12 |
| IUPAC Name | [(E,1S,2S)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate |
| SMILES | C[C@@H](/C=C/C(=O)Nc1ccccc1N)[C@H](OC(=O)Nc1ccc(Br)cc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C27H28BrN3O5/c1-18(9-14-25(33)31-24-8-3-2-7-23(24)29)26(19-5-4-6-22(17-19)35-16-15-32)36-27(34)30-21-12-10-20(28)11-13-21/h2-14,17-18,26,32H,15-16,29H2,1H3,(H,30,34)(H,31,33)/b14-9+/t18-,26-/m0/s1 |
| InChIKey | STNXBPGRVDTBJB-NIRBSDPLSA-N |
| XLogP | 5.52 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.44 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|