C25H24BrN3O4 — CID 23920822
[(E,1R,2R)-5-(2-aminoanilino)-1-(4-hydroxyphenyl)-2-methyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate (PubChem CID 23920822) has the molecular formula C25H24BrN3O4 and a molecular weight of 510.39 g/mol. Its IUPAC name is [(E,1R,2R)-5-(2-aminoanilino)-1-(4-hydroxyphenyl)-2-methyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate.
| Compound Name | [(E,1R,2R)-5-(2-aminoanilino)-1-(4-hydroxyphenyl)-2-methyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 23920822 |
| Molecular Formula | C25H24BrN3O4 |
| Molecular Weight | 510.39 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | [(E,1R,2R)-5-(2-aminoanilino)-1-(4-hydroxyphenyl)-2-methyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate |
| SMILES | C[C@H](/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)Nc1ccc(Br)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C25H24BrN3O4/c1-16(6-15-23(31)29-22-5-3-2-4-21(22)27)24(17-7-13-20(30)14-8-17)33-25(32)28-19-11-9-18(26)10-12-19/h2-16,24,30H,27H2,1H3,(H,28,32)(H,29,31)/b15-6+/t16-,24-/m1/s1 |
| InChIKey | QDXILABIGWJWQR-YEDINWQQSA-N |
| XLogP | 5.86 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.39 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|