C30H26BrN3O5 — CID 23864964
[(E,1S,2S)-5-(2-aminoanilino)-1-(4-hydroxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-(4-bromophenyl)carbamate (PubChem CID 23864964) has the molecular formula C30H26BrN3O5 and a molecular weight of 588.46 g/mol. Its IUPAC name is [(E,1S,2S)-5-(2-aminoanilino)-1-(4-hydroxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-(4-bromophenyl)carbamate.
| Compound Name | [(E,1S,2S)-5-(2-aminoanilino)-1-(4-hydroxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 23864964 |
| Molecular Formula | C30H26BrN3O5 |
| Molecular Weight | 588.46 g/mol |
| Exact Mass | 587.11 |
| IUPAC Name | [(E,1S,2S)-5-(2-aminoanilino)-1-(4-hydroxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-(4-bromophenyl)carbamate |
| SMILES | Nc1ccccc1NC(=O)/C=C/[C@H](Oc1ccccc1)[C@@H](OC(=O)Nc1ccc(Br)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C30H26BrN3O5/c31-21-12-14-22(15-13-21)33-30(37)39-29(20-10-16-23(35)17-11-20)27(38-24-6-2-1-3-7-24)18-19-28(36)34-26-9-5-4-8-25(26)32/h1-19,27,29,35H,32H2,(H,33,37)(H,34,36)/b19-18+/t27-,29-/m0/s1 |
| InChIKey | JQMMGXZYNMUYQO-UKYPGYCISA-N |
| XLogP | 6.67 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.46 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|