C32H31N3O6S — CID 23778621
[(E,1R,2R)-5-(2-aminoanilino)-1-(3-hydroxy-4-methoxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23778621) has the molecular formula C32H31N3O6S and a molecular weight of 585.68 g/mol. Its IUPAC name is [(E,1R,2R)-5-(2-aminoanilino)-1-(3-hydroxy-4-methoxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1R,2R)-5-(2-aminoanilino)-1-(3-hydroxy-4-methoxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23778621 |
| Molecular Formula | C32H31N3O6S |
| Molecular Weight | 585.68 g/mol |
| Exact Mass | 585.19 |
| IUPAC Name | [(E,1R,2R)-5-(2-aminoanilino)-1-(3-hydroxy-4-methoxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | COc1ccc([C@@H](OC(=O)Nc2ccc(SC)cc2)[C@@H](/C=C/C(=O)Nc2ccccc2N)Oc2ccccc2)cc1O |
| InChI | InChI=1S/C32H31N3O6S/c1-39-28-17-12-21(20-27(28)36)31(41-32(38)34-22-13-15-24(42-2)16-14-22)29(40-23-8-4-3-5-9-23)18-19-30(37)35-26-11-7-6-10-25(26)33/h3-20,29,31,36H,33H2,1-2H3,(H,34,38)(H,35,37)/b19-18+/t29-,31-/m1/s1 |
| InChIKey | MVOFCBLHRJNGLE-DWTIYTGRSA-N |
| XLogP | 6.64 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.68 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|