C25H23FN2O6 — CID 23749897
[(E,1S,2S)-1-(3-fluoro-4-hydroxyphenyl)-5-(hydroxyamino)-5-oxo-2-phenoxypent-3-enyl] N-(4-methylphenyl)carbamate (PubChem CID 23749897) has the molecular formula C25H23FN2O6 and a molecular weight of 466.47 g/mol. Its IUPAC name is [(E,1S,2S)-1-(3-fluoro-4-hydroxyphenyl)-5-(hydroxyamino)-5-oxo-2-phenoxypent-3-enyl] N-(4-methylphenyl)carbamate.
| Compound Name | [(E,1S,2S)-1-(3-fluoro-4-hydroxyphenyl)-5-(hydroxyamino)-5-oxo-2-phenoxypent-3-enyl] N-(4-methylphenyl)carbamate |
|---|---|
| PubChem CID | 23749897 |
| Molecular Formula | C25H23FN2O6 |
| Molecular Weight | 466.47 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | [(E,1S,2S)-1-(3-fluoro-4-hydroxyphenyl)-5-(hydroxyamino)-5-oxo-2-phenoxypent-3-enyl] N-(4-methylphenyl)carbamate |
| SMILES | Cc1ccc(NC(=O)O[C@@H](c2ccc(O)c(F)c2)[C@H](/C=C/C(=O)NO)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C25H23FN2O6/c1-16-7-10-18(11-8-16)27-25(31)34-24(17-9-12-21(29)20(26)15-17)22(13-14-23(30)28-32)33-19-5-3-2-4-6-19/h2-15,22,24,29,32H,1H3,(H,27,31)(H,28,30)/b14-13+/t22-,24-/m0/s1 |
| InChIKey | PDUUAVQDDJWWNL-OUUFLIKUSA-N |
| XLogP | 4.64 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|