C20H20FNO5S — CID 23836618
(E,4R,5R)-5-(3-fluoro-4-hydroxyphenyl)-4-methyl-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid (PubChem CID 23836618) has the molecular formula C20H20FNO5S and a molecular weight of 405.45 g/mol. Its IUPAC name is (E,4R,5R)-5-(3-fluoro-4-hydroxyphenyl)-4-methyl-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid.
| Compound Name | (E,4R,5R)-5-(3-fluoro-4-hydroxyphenyl)-4-methyl-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid |
|---|---|
| PubChem CID | 23836618 |
| Molecular Formula | C20H20FNO5S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.10 |
| IUPAC Name | (E,4R,5R)-5-(3-fluoro-4-hydroxyphenyl)-4-methyl-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid |
| SMILES | CSc1ccc(NC(=O)O[C@@H](c2ccc(O)c(F)c2)[C@H](C)/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C20H20FNO5S/c1-12(3-10-18(24)25)19(13-4-9-17(23)16(21)11-13)27-20(26)22-14-5-7-15(28-2)8-6-14/h3-12,19,23H,1-2H3,(H,22,26)(H,24,25)/b10-3+/t12-,19-/m1/s1 |
| InChIKey | WCIVHGDSKHQXFI-PXARVBLNSA-N |
| XLogP | 4.82 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|