C22H25NO6S — CID 23892851
(E,4R,5R)-5-[2-(2-hydroxyethoxy)phenyl]-4-methyl-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid (PubChem CID 23892851) has the molecular formula C22H25NO6S and a molecular weight of 431.51 g/mol. Its IUPAC name is (E,4R,5R)-5-[2-(2-hydroxyethoxy)phenyl]-4-methyl-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid.
| Compound Name | (E,4R,5R)-5-[2-(2-hydroxyethoxy)phenyl]-4-methyl-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid |
|---|---|
| PubChem CID | 23892851 |
| Molecular Formula | C22H25NO6S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | (E,4R,5R)-5-[2-(2-hydroxyethoxy)phenyl]-4-methyl-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid |
| SMILES | CSc1ccc(NC(=O)O[C@@H](c2ccccc2OCCO)[C@H](C)/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C22H25NO6S/c1-15(7-12-20(25)26)21(18-5-3-4-6-19(18)28-14-13-24)29-22(27)23-16-8-10-17(30-2)11-9-16/h3-12,15,21,24H,13-14H2,1-2H3,(H,23,27)(H,25,26)/b12-7+/t15-,21-/m1/s1 |
| InChIKey | ZKLCUYVAVYVLRE-HDTDPIDVSA-N |
| XLogP | 4.35 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|