C22H23NO7 — CID 23892804
(E,4R,5S)-5-(benzoylcarbamoyloxy)-5-[2-(2-hydroxyethoxy)phenyl]-4-methylpent-2-enoic acid (PubChem CID 23892804) has the molecular formula C22H23NO7 and a molecular weight of 413.43 g/mol. Its IUPAC name is (E,4R,5S)-5-(benzoylcarbamoyloxy)-5-[2-(2-hydroxyethoxy)phenyl]-4-methylpent-2-enoic acid.
| Compound Name | (E,4R,5S)-5-(benzoylcarbamoyloxy)-5-[2-(2-hydroxyethoxy)phenyl]-4-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 23892804 |
| Molecular Formula | C22H23NO7 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.15 |
| IUPAC Name | (E,4R,5S)-5-(benzoylcarbamoyloxy)-5-[2-(2-hydroxyethoxy)phenyl]-4-methylpent-2-enoic acid |
| SMILES | C[C@H](/C=C/C(=O)O)[C@H](OC(=O)NC(=O)c1ccccc1)c1ccccc1OCCO |
| InChI | InChI=1S/C22H23NO7/c1-15(11-12-19(25)26)20(17-9-5-6-10-18(17)29-14-13-24)30-22(28)23-21(27)16-7-3-2-4-8-16/h2-12,15,20,24H,13-14H2,1H3,(H,25,26)(H,23,27,28)/b12-11+/t15-,20+/m1/s1 |
| InChIKey | DWFJBACMYWABFS-GPQSEKFTSA-N |
| XLogP | 2.94 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|