C22H24N2O7 — CID 23836887
[(E,1S,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate (PubChem CID 23836887) has the molecular formula C22H24N2O7 and a molecular weight of 428.44 g/mol. Its IUPAC name is [(E,1S,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1S,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23836887 |
| Molecular Formula | C22H24N2O7 |
| Molecular Weight | 428.44 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [(E,1S,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-benzoylcarbamate |
| SMILES | C[C@H](/C=C/C(=O)NO)[C@H](OC(=O)NC(=O)c1ccccc1)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C22H24N2O7/c1-15(7-12-19(26)24-29)20(16-8-10-18(11-9-16)30-14-13-25)31-22(28)23-21(27)17-5-3-2-4-6-17/h2-12,15,20,25,29H,13-14H2,1H3,(H,24,26)(H,23,27,28)/b12-7+/t15-,20+/m1/s1 |
| InChIKey | ZYOBCIQXWXUCEM-LTOJDGJDSA-N |
| XLogP | 2.36 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|