C24H26F2N2O6 — CID 23846796
[(1S,2R,3E,5E)-7-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2,5-dimethyl-7-oxohepta-3,5-dienyl] N-(2,4-difluorophenyl)carbamate (PubChem CID 23846796) has the molecular formula C24H26F2N2O6 and a molecular weight of 476.48 g/mol. Its IUPAC name is [(1S,2R,3E,5E)-7-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2,5-dimethyl-7-oxohepta-3,5-dienyl] N-(2,4-difluorophenyl)carbamate.
| Compound Name | [(1S,2R,3E,5E)-7-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2,5-dimethyl-7-oxohepta-3,5-dienyl] N-(2,4-difluorophenyl)carbamate |
|---|---|
| PubChem CID | 23846796 |
| Molecular Formula | C24H26F2N2O6 |
| Molecular Weight | 476.48 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | [(1S,2R,3E,5E)-7-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2,5-dimethyl-7-oxohepta-3,5-dienyl] N-(2,4-difluorophenyl)carbamate |
| SMILES | CC(/C=C/[C@@H](C)[C@H](OC(=O)Nc1ccc(F)cc1F)c1ccc(OCCO)cc1)=C\C(=O)NO |
| InChI | InChI=1S/C24H26F2N2O6/c1-15(13-22(30)28-32)3-4-16(2)23(17-5-8-19(9-6-17)33-12-11-29)34-24(31)27-21-10-7-18(25)14-20(21)26/h3-10,13-14,16,23,29,32H,11-12H2,1-2H3,(H,27,31)(H,28,30)/b4-3+,15-13+/t16-,23+/m1/s1 |
| InChIKey | JIPVKPWKCPHIPJ-VLDWAQLESA-N |
| XLogP | 4.27 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.48 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|