C24H25F2NO6 — CID 23789198
prop-2-enyl (E,5R)-5-[(2,4-difluorophenyl)carbamoyloxy]-5-[4-(2-hydroxyethoxy)phenyl]-3-methylpent-2-enoate (PubChem CID 23789198) has the molecular formula C24H25F2NO6 and a molecular weight of 461.46 g/mol. Its IUPAC name is prop-2-enyl (E,5R)-5-[(2,4-difluorophenyl)carbamoyloxy]-5-[4-(2-hydroxyethoxy)phenyl]-3-methylpent-2-enoate.
| Compound Name | prop-2-enyl (E,5R)-5-[(2,4-difluorophenyl)carbamoyloxy]-5-[4-(2-hydroxyethoxy)phenyl]-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 23789198 |
| Molecular Formula | C24H25F2NO6 |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | prop-2-enyl (E,5R)-5-[(2,4-difluorophenyl)carbamoyloxy]-5-[4-(2-hydroxyethoxy)phenyl]-3-methylpent-2-enoate |
| SMILES | C=CCOC(=O)/C=C(\C)C[C@@H](OC(=O)Nc1ccc(F)cc1F)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C24H25F2NO6/c1-3-11-32-23(29)14-16(2)13-22(17-4-7-19(8-5-17)31-12-10-28)33-24(30)27-21-9-6-18(25)15-20(21)26/h3-9,14-15,22,28H,1,10-13H2,2H3,(H,27,30)/b16-14+/t22-/m1/s1 |
| InChIKey | RQPUZDMJMHBRPR-KJLVKZSNSA-N |
| XLogP | 4.69 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|