C24H27F2NO6 — CID 23958403
ethyl (E,5S)-5-[(2,4-difluorophenyl)carbamoyloxy]-5-[4-(2-hydroxyethoxy)phenyl]-2,3-dimethylpent-2-enoate (PubChem CID 23958403) has the molecular formula C24H27F2NO6 and a molecular weight of 463.48 g/mol. Its IUPAC name is ethyl (E,5S)-5-[(2,4-difluorophenyl)carbamoyloxy]-5-[4-(2-hydroxyethoxy)phenyl]-2,3-dimethylpent-2-enoate.
| Compound Name | ethyl (E,5S)-5-[(2,4-difluorophenyl)carbamoyloxy]-5-[4-(2-hydroxyethoxy)phenyl]-2,3-dimethylpent-2-enoate |
|---|---|
| PubChem CID | 23958403 |
| Molecular Formula | C24H27F2NO6 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | ethyl (E,5S)-5-[(2,4-difluorophenyl)carbamoyloxy]-5-[4-(2-hydroxyethoxy)phenyl]-2,3-dimethylpent-2-enoate |
| SMILES | CCOC(=O)/C(C)=C(\C)C[C@H](OC(=O)Nc1ccc(F)cc1F)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C24H27F2NO6/c1-4-31-23(29)16(3)15(2)13-22(17-5-8-19(9-6-17)32-12-11-28)33-24(30)27-21-10-7-18(25)14-20(21)26/h5-10,14,22,28H,4,11-13H2,1-3H3,(H,27,30)/b16-15+/t22-/m0/s1 |
| InChIKey | KRIZUMHGZIZLPJ-BQXQKYNTSA-N |
| XLogP | 4.92 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|