C25H27F2NO6 — CID 23760260
prop-2-enyl (E,7S)-7-[(2,4-difluorophenyl)carbamoyloxy]-7-[4-(2-hydroxyethoxy)phenyl]hept-2-enoate (PubChem CID 23760260) has the molecular formula C25H27F2NO6 and a molecular weight of 475.49 g/mol. Its IUPAC name is prop-2-enyl (E,7S)-7-[(2,4-difluorophenyl)carbamoyloxy]-7-[4-(2-hydroxyethoxy)phenyl]hept-2-enoate.
| Compound Name | prop-2-enyl (E,7S)-7-[(2,4-difluorophenyl)carbamoyloxy]-7-[4-(2-hydroxyethoxy)phenyl]hept-2-enoate |
|---|---|
| PubChem CID | 23760260 |
| Molecular Formula | C25H27F2NO6 |
| Molecular Weight | 475.49 g/mol |
| Exact Mass | 475.18 |
| IUPAC Name | prop-2-enyl (E,7S)-7-[(2,4-difluorophenyl)carbamoyloxy]-7-[4-(2-hydroxyethoxy)phenyl]hept-2-enoate |
| SMILES | C=CCOC(=O)/C=C/CCC[C@H](OC(=O)Nc1ccc(F)cc1F)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C25H27F2NO6/c1-2-15-33-24(30)7-5-3-4-6-23(18-8-11-20(12-9-18)32-16-14-29)34-25(31)28-22-13-10-19(26)17-21(22)27/h2,5,7-13,17,23,29H,1,3-4,6,14-16H2,(H,28,31)/b7-5+/t23-/m0/s1 |
| InChIKey | MYVBRLOHEYKIIF-BVBLWJPBSA-N |
| XLogP | 5.08 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|