C29H31N3O6 — CID 23836820
[(E,1R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-7-oxohept-5-enyl] N-benzoylcarbamate (PubChem CID 23836820) has the molecular formula C29H31N3O6 and a molecular weight of 517.58 g/mol. Its IUPAC name is [(E,1R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-7-oxohept-5-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-7-oxohept-5-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23836820 |
| Molecular Formula | C29H31N3O6 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | [(E,1R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-7-oxohept-5-enyl] N-benzoylcarbamate |
| SMILES | Nc1ccccc1NC(=O)/C=C/CCC[C@@H](OC(=O)NC(=O)c1ccccc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C29H31N3O6/c30-24-14-7-8-15-25(24)31-27(34)17-6-2-5-16-26(22-12-9-13-23(20-22)37-19-18-33)38-29(36)32-28(35)21-10-3-1-4-11-21/h1,3-4,6-15,17,20,26,33H,2,5,16,18-19,30H2,(H,31,34)(H,32,35,36)/b17-6+/t26-/m1/s1 |
| InChIKey | PDDACPZJNRFVTJ-QHBWSUAYSA-N |
| XLogP | 4.61 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|