C29H33N3O5 — CID 23865122
[(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-phenylcarbamate (PubChem CID 23865122) has the molecular formula C29H33N3O5 and a molecular weight of 503.60 g/mol. Its IUPAC name is [(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-phenylcarbamate.
| Compound Name | [(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 23865122 |
| Molecular Formula | C29H33N3O5 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | [(E,1R,2R)-7-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2-methyl-7-oxohept-5-enyl] N-phenylcarbamate |
| SMILES | C[C@H](CC/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)Nc1ccccc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C29H33N3O5/c1-21(10-5-8-17-27(34)32-26-16-7-6-15-25(26)30)28(22-11-9-14-24(20-22)36-19-18-33)37-29(35)31-23-12-3-2-4-13-23/h2-4,6-9,11-17,20-21,28,33H,5,10,18-19,30H2,1H3,(H,31,35)(H,32,34)/b17-8+/t21-,28-/m1/s1 |
| InChIKey | SGCSOLKEPLABKU-DSWUINQUSA-N |
| XLogP | 5.54 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|