C23H26BrNO6 — CID 23920927
(E,6R,7S)-7-[(4-bromophenyl)carbamoyloxy]-7-[3-(2-hydroxyethoxy)phenyl]-6-methylhept-2-enoic acid (PubChem CID 23920927) has the molecular formula C23H26BrNO6 and a molecular weight of 492.37 g/mol. Its IUPAC name is (E,6R,7S)-7-[(4-bromophenyl)carbamoyloxy]-7-[3-(2-hydroxyethoxy)phenyl]-6-methylhept-2-enoic acid.
| Compound Name | (E,6R,7S)-7-[(4-bromophenyl)carbamoyloxy]-7-[3-(2-hydroxyethoxy)phenyl]-6-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 23920927 |
| Molecular Formula | C23H26BrNO6 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.09 |
| IUPAC Name | (E,6R,7S)-7-[(4-bromophenyl)carbamoyloxy]-7-[3-(2-hydroxyethoxy)phenyl]-6-methylhept-2-enoic acid |
| SMILES | C[C@H](CC/C=C/C(=O)O)[C@H](OC(=O)Nc1ccc(Br)cc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C23H26BrNO6/c1-16(5-2-3-8-21(27)28)22(17-6-4-7-20(15-17)30-14-13-26)31-23(29)25-19-11-9-18(24)10-12-19/h3-4,6-12,15-16,22,26H,2,5,13-14H2,1H3,(H,25,29)(H,27,28)/b8-3+/t16-,22+/m1/s1 |
| InChIKey | AYUZKENGFOCLAC-BBUDVVLJSA-N |
| XLogP | 5.17 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|