C25H29NO8 — CID 23865143
(E,6S,7S)-7-[(4-acetylphenyl)carbamoyloxy]-7-[3-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoic acid (PubChem CID 23865143) has the molecular formula C25H29NO8 and a molecular weight of 471.51 g/mol. Its IUPAC name is (E,6S,7S)-7-[(4-acetylphenyl)carbamoyloxy]-7-[3-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoic acid.
| Compound Name | (E,6S,7S)-7-[(4-acetylphenyl)carbamoyloxy]-7-[3-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoic acid |
|---|---|
| PubChem CID | 23865143 |
| Molecular Formula | C25H29NO8 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (E,6S,7S)-7-[(4-acetylphenyl)carbamoyloxy]-7-[3-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoic acid |
| SMILES | CO[C@@H](CC/C=C/C(=O)O)[C@@H](OC(=O)Nc1ccc(C(C)=O)cc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C25H29NO8/c1-17(28)18-10-12-20(13-11-18)26-25(31)34-24(22(32-2)8-3-4-9-23(29)30)19-6-5-7-21(16-19)33-15-14-27/h4-7,9-13,16,22,24,27H,3,8,14-15H2,1-2H3,(H,26,31)(H,29,30)/b9-4+/t22-,24-/m0/s1 |
| InChIKey | OPTZBGPHUCWYRM-BEIZNKGWSA-N |
| XLogP | 3.99 |
| TPSA | 131.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|