C24H27NO9 — CID 23865139
(E,6S,7S)-7-(1,3-benzodioxol-5-ylcarbamoyloxy)-7-[3-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoic acid (PubChem CID 23865139) has the molecular formula C24H27NO9 and a molecular weight of 473.48 g/mol. Its IUPAC name is (E,6S,7S)-7-(1,3-benzodioxol-5-ylcarbamoyloxy)-7-[3-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoic acid.
| Compound Name | (E,6S,7S)-7-(1,3-benzodioxol-5-ylcarbamoyloxy)-7-[3-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoic acid |
|---|---|
| PubChem CID | 23865139 |
| Molecular Formula | C24H27NO9 |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | (E,6S,7S)-7-(1,3-benzodioxol-5-ylcarbamoyloxy)-7-[3-(2-hydroxyethoxy)phenyl]-6-methoxyhept-2-enoic acid |
| SMILES | CO[C@@H](CC/C=C/C(=O)O)[C@@H](OC(=O)Nc1ccc2c(c1)OCO2)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C24H27NO9/c1-30-20(7-2-3-8-22(27)28)23(16-5-4-6-18(13-16)31-12-11-26)34-24(29)25-17-9-10-19-21(14-17)33-15-32-19/h3-6,8-10,13-14,20,23,26H,2,7,11-12,15H2,1H3,(H,25,29)(H,27,28)/b8-3+/t20-,23-/m0/s1 |
| InChIKey | SUJZYYZAVHXDDG-UTKZXYPPSA-N |
| XLogP | 3.51 |
| TPSA | 132.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|