C22H24N2O8 — CID 23836890
[(E,1S,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate (PubChem CID 23836890) has the molecular formula C22H24N2O8 and a molecular weight of 444.44 g/mol. Its IUPAC name is [(E,1S,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate.
| Compound Name | [(E,1S,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 23836890 |
| Molecular Formula | C22H24N2O8 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.15 |
| IUPAC Name | [(E,1S,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
| SMILES | C[C@H](/C=C/C(=O)NO)[C@H](OC(=O)Nc1ccc2c(c1)OCO2)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C22H24N2O8/c1-14(2-9-20(26)24-28)21(15-3-6-17(7-4-15)29-11-10-25)32-22(27)23-16-5-8-18-19(12-16)31-13-30-18/h2-9,12,14,21,25,28H,10-11,13H2,1H3,(H,23,27)(H,24,26)/b9-2+/t14-,21+/m1/s1 |
| InChIKey | RFDUHNSAQMSXHD-CTGGZVQMSA-N |
| XLogP | 2.77 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|