C20H19BrN2O7 — CID 23778799
[(E,1S,2R)-1-(5-bromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate (PubChem CID 23778799) has the molecular formula C20H19BrN2O7 and a molecular weight of 479.28 g/mol. Its IUPAC name is [(E,1S,2R)-1-(5-bromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate.
| Compound Name | [(E,1S,2R)-1-(5-bromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 23778799 |
| Molecular Formula | C20H19BrN2O7 |
| Molecular Weight | 479.28 g/mol |
| Exact Mass | 478.04 |
| IUPAC Name | [(E,1S,2R)-1-(5-bromo-2-hydroxyphenyl)-5-(hydroxyamino)-2-methyl-5-oxopent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
| SMILES | C[C@H](/C=C/C(=O)NO)[C@H](OC(=O)Nc1ccc2c(c1)OCO2)c1cc(Br)ccc1O |
| InChI | InChI=1S/C20H19BrN2O7/c1-11(2-7-18(25)23-27)19(14-8-12(21)3-5-15(14)24)30-20(26)22-13-4-6-16-17(9-13)29-10-28-16/h2-9,11,19,24,27H,10H2,1H3,(H,22,26)(H,23,25)/b7-2+/t11-,19+/m1/s1 |
| InChIKey | IORVYHKMBIJVBM-GPHUDNJESA-N |
| XLogP | 3.87 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|