C25H21BrN2O8 — CID 23920661
[(E,1S,2S)-1-(5-bromo-2-hydroxyphenyl)-5-(hydroxyamino)-5-oxo-2-phenoxypent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate (PubChem CID 23920661) has the molecular formula C25H21BrN2O8 and a molecular weight of 557.35 g/mol. Its IUPAC name is [(E,1S,2S)-1-(5-bromo-2-hydroxyphenyl)-5-(hydroxyamino)-5-oxo-2-phenoxypent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate.
| Compound Name | [(E,1S,2S)-1-(5-bromo-2-hydroxyphenyl)-5-(hydroxyamino)-5-oxo-2-phenoxypent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 23920661 |
| Molecular Formula | C25H21BrN2O8 |
| Molecular Weight | 557.35 g/mol |
| Exact Mass | 556.05 |
| IUPAC Name | [(E,1S,2S)-1-(5-bromo-2-hydroxyphenyl)-5-(hydroxyamino)-5-oxo-2-phenoxypent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
| SMILES | O=C(/C=C/[C@H](Oc1ccccc1)[C@@H](OC(=O)Nc1ccc2c(c1)OCO2)c1cc(Br)ccc1O)NO |
| InChI | InChI=1S/C25H21BrN2O8/c26-15-6-8-19(29)18(12-15)24(21(10-11-23(30)28-32)35-17-4-2-1-3-5-17)36-25(31)27-16-7-9-20-22(13-16)34-14-33-20/h1-13,21,24,29,32H,14H2,(H,27,31)(H,28,30)/b11-10+/t21-,24-/m0/s1 |
| InChIKey | BOYMTPRYARDEKP-DSQTUEOOSA-N |
| XLogP | 4.68 |
| TPSA | 135.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|