C31H27N3O7 — CID 23808001
[(E,1R,2R)-5-(2-aminoanilino)-1-(4-hydroxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate (PubChem CID 23808001) has the molecular formula C31H27N3O7 and a molecular weight of 553.57 g/mol. Its IUPAC name is [(E,1R,2R)-5-(2-aminoanilino)-1-(4-hydroxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate.
| Compound Name | [(E,1R,2R)-5-(2-aminoanilino)-1-(4-hydroxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
|---|---|
| PubChem CID | 23808001 |
| Molecular Formula | C31H27N3O7 |
| Molecular Weight | 553.57 g/mol |
| Exact Mass | 553.18 |
| IUPAC Name | [(E,1R,2R)-5-(2-aminoanilino)-1-(4-hydroxyphenyl)-5-oxo-2-phenoxypent-3-enyl] N-(1,3-benzodioxol-5-yl)carbamate |
| SMILES | Nc1ccccc1NC(=O)/C=C/[C@@H](Oc1ccccc1)[C@H](OC(=O)Nc1ccc2c(c1)OCO2)c1ccc(O)cc1 |
| InChI | InChI=1S/C31H27N3O7/c32-24-8-4-5-9-25(24)34-29(36)17-16-27(40-23-6-2-1-3-7-23)30(20-10-13-22(35)14-11-20)41-31(37)33-21-12-15-26-28(18-21)39-19-38-26/h1-18,27,30,35H,19,32H2,(H,33,37)(H,34,36)/b17-16+/t27-,30-/m1/s1 |
| InChIKey | HSRYDNIRJVYXFL-PLNHKIIRSA-N |
| XLogP | 5.64 |
| TPSA | 141.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|