C26H23NO7 — CID 23836685
(E,4S,5S)-5-[(4-acetylphenyl)carbamoyloxy]-5-(4-hydroxyphenyl)-4-phenoxypent-2-enoic acid (PubChem CID 23836685) has the molecular formula C26H23NO7 and a molecular weight of 461.47 g/mol. Its IUPAC name is (E,4S,5S)-5-[(4-acetylphenyl)carbamoyloxy]-5-(4-hydroxyphenyl)-4-phenoxypent-2-enoic acid.
| Compound Name | (E,4S,5S)-5-[(4-acetylphenyl)carbamoyloxy]-5-(4-hydroxyphenyl)-4-phenoxypent-2-enoic acid |
|---|---|
| PubChem CID | 23836685 |
| Molecular Formula | C26H23NO7 |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | (E,4S,5S)-5-[(4-acetylphenyl)carbamoyloxy]-5-(4-hydroxyphenyl)-4-phenoxypent-2-enoic acid |
| SMILES | CC(=O)c1ccc(NC(=O)O[C@@H](c2ccc(O)cc2)[C@H](/C=C/C(=O)O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C26H23NO7/c1-17(28)18-7-11-20(12-8-18)27-26(32)34-25(19-9-13-21(29)14-10-19)23(15-16-24(30)31)33-22-5-3-2-4-6-22/h2-16,23,25,29H,1H3,(H,27,32)(H,30,31)/b16-15+/t23-,25-/m0/s1 |
| InChIKey | DJDHHXZYRWRRCA-AGZMBGAISA-N |
| XLogP | 4.97 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|