C21H19Br2NO7 — CID 23807760
(E,4R,5R)-5-[(4-acetylphenyl)carbamoyloxy]-5-(3,5-dibromo-2-hydroxyphenyl)-4-methoxypent-2-enoic acid (PubChem CID 23807760) has the molecular formula C21H19Br2NO7 and a molecular weight of 557.19 g/mol. Its IUPAC name is (E,4R,5R)-5-[(4-acetylphenyl)carbamoyloxy]-5-(3,5-dibromo-2-hydroxyphenyl)-4-methoxypent-2-enoic acid.
| Compound Name | (E,4R,5R)-5-[(4-acetylphenyl)carbamoyloxy]-5-(3,5-dibromo-2-hydroxyphenyl)-4-methoxypent-2-enoic acid |
|---|---|
| PubChem CID | 23807760 |
| Molecular Formula | C21H19Br2NO7 |
| Molecular Weight | 557.19 g/mol |
| Exact Mass | 554.95 |
| IUPAC Name | (E,4R,5R)-5-[(4-acetylphenyl)carbamoyloxy]-5-(3,5-dibromo-2-hydroxyphenyl)-4-methoxypent-2-enoic acid |
| SMILES | CO[C@H](/C=C/C(=O)O)[C@H](OC(=O)Nc1ccc(C(C)=O)cc1)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C21H19Br2NO7/c1-11(25)12-3-5-14(6-4-12)24-21(29)31-20(17(30-2)7-8-18(26)27)15-9-13(22)10-16(23)19(15)28/h3-10,17,20,28H,1-2H3,(H,24,29)(H,26,27)/b8-7+/t17-,20-/m1/s1 |
| InChIKey | INEWMFIWXZIMQK-JCTQASJRSA-N |
| XLogP | 5.07 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.19 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|