C28H21Br2NO6 — CID 23976516
(E,4S,5S)-5-(3,5-dibromo-2-hydroxyphenyl)-5-(naphthalen-1-ylcarbamoyloxy)-4-phenoxypent-2-enoic acid (PubChem CID 23976516) has the molecular formula C28H21Br2NO6 and a molecular weight of 627.29 g/mol. Its IUPAC name is (E,4S,5S)-5-(3,5-dibromo-2-hydroxyphenyl)-5-(naphthalen-1-ylcarbamoyloxy)-4-phenoxypent-2-enoic acid.
| Compound Name | (E,4S,5S)-5-(3,5-dibromo-2-hydroxyphenyl)-5-(naphthalen-1-ylcarbamoyloxy)-4-phenoxypent-2-enoic acid |
|---|---|
| PubChem CID | 23976516 |
| Molecular Formula | C28H21Br2NO6 |
| Molecular Weight | 627.29 g/mol |
| Exact Mass | 624.97 |
| IUPAC Name | (E,4S,5S)-5-(3,5-dibromo-2-hydroxyphenyl)-5-(naphthalen-1-ylcarbamoyloxy)-4-phenoxypent-2-enoic acid |
| SMILES | O=C(O)/C=C/[C@H](Oc1ccccc1)[C@@H](OC(=O)Nc1cccc2ccccc12)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C28H21Br2NO6/c29-18-15-21(26(34)22(30)16-18)27(24(13-14-25(32)33)36-19-9-2-1-3-10-19)37-28(35)31-23-12-6-8-17-7-4-5-11-20(17)23/h1-16,24,27,34H,(H,31,35)(H,32,33)/b14-13+/t24-,27-/m0/s1 |
| InChIKey | AVEWRFPNHYECJD-FOIRAZDFSA-N |
| XLogP | 7.45 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.29 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|