C23H21NO6 — CID 23976759
(E,4S,5S)-5-(4-hydroxyphenyl)-4-methoxy-5-(naphthalen-1-ylcarbamoyloxy)pent-2-enoic acid (PubChem CID 23976759) has the molecular formula C23H21NO6 and a molecular weight of 407.42 g/mol. Its IUPAC name is (E,4S,5S)-5-(4-hydroxyphenyl)-4-methoxy-5-(naphthalen-1-ylcarbamoyloxy)pent-2-enoic acid.
| Compound Name | (E,4S,5S)-5-(4-hydroxyphenyl)-4-methoxy-5-(naphthalen-1-ylcarbamoyloxy)pent-2-enoic acid |
|---|---|
| PubChem CID | 23976759 |
| Molecular Formula | C23H21NO6 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | (E,4S,5S)-5-(4-hydroxyphenyl)-4-methoxy-5-(naphthalen-1-ylcarbamoyloxy)pent-2-enoic acid |
| SMILES | CO[C@@H](/C=C/C(=O)O)[C@@H](OC(=O)Nc1cccc2ccccc12)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H21NO6/c1-29-20(13-14-21(26)27)22(16-9-11-17(25)12-10-16)30-23(28)24-19-8-4-6-15-5-2-3-7-18(15)19/h2-14,20,22,25H,1H3,(H,24,28)(H,26,27)/b14-13+/t20-,22-/m0/s1 |
| InChIKey | JCQRKKGNLWZDJY-IEEUGTCFSA-N |
| XLogP | 4.49 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|