C24H25NO5S — CID 23749937
[(3S,4R)-4-(4-hydroxyphenyl)-3-methyl-4-(naphthalen-1-ylcarbamoyloxy)butyl] 2-sulfanylacetate (PubChem CID 23749937) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is [(3S,4R)-4-(4-hydroxyphenyl)-3-methyl-4-(naphthalen-1-ylcarbamoyloxy)butyl] 2-sulfanylacetate.
| Compound Name | [(3S,4R)-4-(4-hydroxyphenyl)-3-methyl-4-(naphthalen-1-ylcarbamoyloxy)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23749937 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | [(3S,4R)-4-(4-hydroxyphenyl)-3-methyl-4-(naphthalen-1-ylcarbamoyloxy)butyl] 2-sulfanylacetate |
| SMILES | C[C@@H](CCOC(=O)CS)[C@@H](OC(=O)Nc1cccc2ccccc12)c1ccc(O)cc1 |
| InChI | InChI=1S/C24H25NO5S/c1-16(13-14-29-22(27)15-31)23(18-9-11-19(26)12-10-18)30-24(28)25-21-8-4-6-17-5-2-3-7-20(17)21/h2-12,16,23,26,31H,13-15H2,1H3,(H,25,28)/t16-,23+/m0/s1 |
| InChIKey | LYCFWDVGNSRRRQ-QMHKHESXSA-N |
| XLogP | 5.33 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|