C29H29NO5S — CID 23778695
[(4R)-4-(4-hydroxynaphthalen-1-yl)-3,3-dimethyl-4-(naphthalen-1-ylcarbamoyloxy)butyl] 2-sulfanylacetate (PubChem CID 23778695) has the molecular formula C29H29NO5S and a molecular weight of 503.62 g/mol. Its IUPAC name is [(4R)-4-(4-hydroxynaphthalen-1-yl)-3,3-dimethyl-4-(naphthalen-1-ylcarbamoyloxy)butyl] 2-sulfanylacetate.
| Compound Name | [(4R)-4-(4-hydroxynaphthalen-1-yl)-3,3-dimethyl-4-(naphthalen-1-ylcarbamoyloxy)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23778695 |
| Molecular Formula | C29H29NO5S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | [(4R)-4-(4-hydroxynaphthalen-1-yl)-3,3-dimethyl-4-(naphthalen-1-ylcarbamoyloxy)butyl] 2-sulfanylacetate |
| SMILES | CC(C)(CCOC(=O)CS)[C@@H](OC(=O)Nc1cccc2ccccc12)c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C29H29NO5S/c1-29(2,16-17-34-26(32)18-36)27(23-14-15-25(31)22-12-6-5-11-21(22)23)35-28(33)30-24-13-7-9-19-8-3-4-10-20(19)24/h3-15,27,31,36H,16-18H2,1-2H3,(H,30,33)/t27-/m0/s1 |
| InChIKey | YYCOGHNKVFUYDU-MHZLTWQESA-N |
| XLogP | 6.88 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|