C24H22N2O5S — CID 23749628
[(4R)-4-[(4-cyanophenyl)carbamoyloxy]-4-(4-hydroxynaphthalen-1-yl)butyl] 2-sulfanylacetate (PubChem CID 23749628) has the molecular formula C24H22N2O5S and a molecular weight of 450.52 g/mol. Its IUPAC name is [(4R)-4-[(4-cyanophenyl)carbamoyloxy]-4-(4-hydroxynaphthalen-1-yl)butyl] 2-sulfanylacetate.
| Compound Name | [(4R)-4-[(4-cyanophenyl)carbamoyloxy]-4-(4-hydroxynaphthalen-1-yl)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23749628 |
| Molecular Formula | C24H22N2O5S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | [(4R)-4-[(4-cyanophenyl)carbamoyloxy]-4-(4-hydroxynaphthalen-1-yl)butyl] 2-sulfanylacetate |
| SMILES | N#Cc1ccc(NC(=O)O[C@H](CCCOC(=O)CS)c2ccc(O)c3ccccc23)cc1 |
| InChI | InChI=1S/C24H22N2O5S/c25-14-16-7-9-17(10-8-16)26-24(29)31-22(6-3-13-30-23(28)15-32)20-11-12-21(27)19-5-2-1-4-18(19)20/h1-2,4-5,7-12,22,27,32H,3,6,13,15H2,(H,26,29)/t22-/m1/s1 |
| InChIKey | DMWXKVJAYNPTTR-JOCHJYFZSA-N |
| XLogP | 4.96 |
| TPSA | 108.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|