C16H18O4S — CID 23836229
[(4R)-4-hydroxy-4-(4-hydroxynaphthalen-1-yl)butyl] 2-sulfanylacetate (PubChem CID 23836229) has the molecular formula C16H18O4S and a molecular weight of 306.38 g/mol. Its IUPAC name is [(4R)-4-hydroxy-4-(4-hydroxynaphthalen-1-yl)butyl] 2-sulfanylacetate.
| Compound Name | [(4R)-4-hydroxy-4-(4-hydroxynaphthalen-1-yl)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23836229 |
| Molecular Formula | C16H18O4S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | [(4R)-4-hydroxy-4-(4-hydroxynaphthalen-1-yl)butyl] 2-sulfanylacetate |
| SMILES | O=C(CS)OCCC[C@@H](O)c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C16H18O4S/c17-14(6-3-9-20-16(19)10-21)13-7-8-15(18)12-5-2-1-4-11(12)13/h1-2,4-5,7-8,14,17-18,21H,3,6,9-10H2/t14-/m1/s1 |
| InChIKey | ZDSIHAHQFNWLSJ-CQSZACIVSA-N |
| XLogP | 2.83 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|