About [(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate
[(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate (PubChem CID 23920371) has the molecular formula C13H17BrO4S
and a molecular weight of 349.25 g/mol. Its IUPAC name is [(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate.
Molecular Properties
| Compound Name | [(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate |
| PubChem CID | 23920371 |
| Molecular Formula | C13H17BrO4S |
| Molecular Weight | 349.25 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | [(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate |
| SMILES | C[C@@H](CCOC(=O)CS)[C@@H](O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C13H17BrO4S/c1-8(4-5-18-12(16)7-19)13(17)10-6-9(14)2-3-11(10)15/h2-3,6,8,13,15,17,19H,4-5,7H2,1H3/t8-,13+/m0/s1 |
| InChIKey | JPHFQCOWWIKFTO-ISVAXAHUSA-N |
| XLogP | 2.69 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.25 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze [(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate?
The IUPAC name of [(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate (CID 23920371) is [(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate.
What is the SMILES notation for [(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate?
The canonical SMILES for [(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate is C[C@@H](CCOC(=O)CS)[C@@H](O)c1cc(Br)ccc1O.
What is the InChIKey of [(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate?
The InChIKey is JPHFQCOWWIKFTO-ISVAXAHUSA-N. The full InChI is InChI=1S/C13H17BrO4S/c1-8(4-5-18-12(16)7-19)13(17)10-6-9(14)2-3-11(10)15/h2-3,6,8,13,15,17,19H,4-5,7H2,1H3/t8-,13+/m0/s1.
What are the key properties of [(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate?
[(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate has a molecular weight of 349.25 g/mol, XLogP of 2.69, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S,4R)-4-(5-bromo-2-hydroxyphenyl)-4-hydroxy-3-methylbutyl] 2-sulfanylacetate is sourced from PubChem (CID 23920371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).