C22H23Br2NO6S — CID 23948362
[(3R,4S)-4-[(4-acetylphenyl)carbamoyloxy]-4-(3,5-dibromo-2-hydroxyphenyl)-3-methylbutyl] 2-sulfanylacetate (PubChem CID 23948362) has the molecular formula C22H23Br2NO6S and a molecular weight of 589.30 g/mol. Its IUPAC name is [(3R,4S)-4-[(4-acetylphenyl)carbamoyloxy]-4-(3,5-dibromo-2-hydroxyphenyl)-3-methylbutyl] 2-sulfanylacetate.
| Compound Name | [(3R,4S)-4-[(4-acetylphenyl)carbamoyloxy]-4-(3,5-dibromo-2-hydroxyphenyl)-3-methylbutyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23948362 |
| Molecular Formula | C22H23Br2NO6S |
| Molecular Weight | 589.30 g/mol |
| Exact Mass | 586.96 |
| IUPAC Name | [(3R,4S)-4-[(4-acetylphenyl)carbamoyloxy]-4-(3,5-dibromo-2-hydroxyphenyl)-3-methylbutyl] 2-sulfanylacetate |
| SMILES | CC(=O)c1ccc(NC(=O)O[C@H](c2cc(Br)cc(Br)c2O)[C@H](C)CCOC(=O)CS)cc1 |
| InChI | InChI=1S/C22H23Br2NO6S/c1-12(7-8-30-19(27)11-32)21(17-9-15(23)10-18(24)20(17)28)31-22(29)25-16-5-3-14(4-6-16)13(2)26/h3-6,9-10,12,21,28,32H,7-8,11H2,1-2H3,(H,25,29)/t12-,21+/m1/s1 |
| InChIKey | VMWRPKZHIZVEBY-GTJPDFRWSA-N |
| XLogP | 5.91 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.30 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|