C24H29NO8S — CID 23749547
[(3R,4R)-4-[(4-acetylphenyl)carbamoyloxy]-3-ethoxy-4-(3-hydroxy-4-methoxyphenyl)butyl] 2-sulfanylacetate (PubChem CID 23749547) has the molecular formula C24H29NO8S and a molecular weight of 491.56 g/mol. Its IUPAC name is [(3R,4R)-4-[(4-acetylphenyl)carbamoyloxy]-3-ethoxy-4-(3-hydroxy-4-methoxyphenyl)butyl] 2-sulfanylacetate.
| Compound Name | [(3R,4R)-4-[(4-acetylphenyl)carbamoyloxy]-3-ethoxy-4-(3-hydroxy-4-methoxyphenyl)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23749547 |
| Molecular Formula | C24H29NO8S |
| Molecular Weight | 491.56 g/mol |
| Exact Mass | 491.16 |
| IUPAC Name | [(3R,4R)-4-[(4-acetylphenyl)carbamoyloxy]-3-ethoxy-4-(3-hydroxy-4-methoxyphenyl)butyl] 2-sulfanylacetate |
| SMILES | CCO[C@H](CCOC(=O)CS)[C@H](OC(=O)Nc1ccc(C(C)=O)cc1)c1ccc(OC)c(O)c1 |
| InChI | InChI=1S/C24H29NO8S/c1-4-31-21(11-12-32-22(28)14-34)23(17-7-10-20(30-3)19(27)13-17)33-24(29)25-18-8-5-16(6-9-18)15(2)26/h5-10,13,21,23,27,34H,4,11-12,14H2,1-3H3,(H,25,29)/t21-,23-/m1/s1 |
| InChIKey | KNJRHCVTJPZXMW-FYYLOGMGSA-N |
| XLogP | 4.16 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.56 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|