C28H29NO8S — CID 23807630
[(3R,4R)-4-[(4-acetylphenyl)carbamoyloxy]-4-(3-hydroxy-4-methoxyphenyl)-3-phenoxybutyl] 2-sulfanylacetate (PubChem CID 23807630) has the molecular formula C28H29NO8S and a molecular weight of 539.61 g/mol. Its IUPAC name is [(3R,4R)-4-[(4-acetylphenyl)carbamoyloxy]-4-(3-hydroxy-4-methoxyphenyl)-3-phenoxybutyl] 2-sulfanylacetate.
| Compound Name | [(3R,4R)-4-[(4-acetylphenyl)carbamoyloxy]-4-(3-hydroxy-4-methoxyphenyl)-3-phenoxybutyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23807630 |
| Molecular Formula | C28H29NO8S |
| Molecular Weight | 539.61 g/mol |
| Exact Mass | 539.16 |
| IUPAC Name | [(3R,4R)-4-[(4-acetylphenyl)carbamoyloxy]-4-(3-hydroxy-4-methoxyphenyl)-3-phenoxybutyl] 2-sulfanylacetate |
| SMILES | COc1ccc([C@@H](OC(=O)Nc2ccc(C(C)=O)cc2)[C@@H](CCOC(=O)CS)Oc2ccccc2)cc1O |
| InChI | InChI=1S/C28H29NO8S/c1-18(30)19-8-11-21(12-9-19)29-28(33)37-27(20-10-13-24(34-2)23(31)16-20)25(14-15-35-26(32)17-38)36-22-6-4-3-5-7-22/h3-13,16,25,27,31,38H,14-15,17H2,1-2H3,(H,29,33)/t25-,27-/m1/s1 |
| InChIKey | YFGRTOSHVLSZMN-XNMGPUDCSA-N |
| XLogP | 5.20 |
| TPSA | 120.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.61 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|