C23H27NO7S — CID 23920831
[(3S,4S)-4-[(4-acetylphenyl)carbamoyloxy]-3-ethoxy-4-(4-hydroxyphenyl)butyl] 2-sulfanylacetate (PubChem CID 23920831) has the molecular formula C23H27NO7S and a molecular weight of 461.54 g/mol. Its IUPAC name is [(3S,4S)-4-[(4-acetylphenyl)carbamoyloxy]-3-ethoxy-4-(4-hydroxyphenyl)butyl] 2-sulfanylacetate.
| Compound Name | [(3S,4S)-4-[(4-acetylphenyl)carbamoyloxy]-3-ethoxy-4-(4-hydroxyphenyl)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23920831 |
| Molecular Formula | C23H27NO7S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | [(3S,4S)-4-[(4-acetylphenyl)carbamoyloxy]-3-ethoxy-4-(4-hydroxyphenyl)butyl] 2-sulfanylacetate |
| SMILES | CCO[C@@H](CCOC(=O)CS)[C@@H](OC(=O)Nc1ccc(C(C)=O)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C23H27NO7S/c1-3-29-20(12-13-30-21(27)14-32)22(17-6-10-19(26)11-7-17)31-23(28)24-18-8-4-16(5-9-18)15(2)25/h4-11,20,22,26,32H,3,12-14H2,1-2H3,(H,24,28)/t20-,22-/m0/s1 |
| InChIKey | VJKXEGWRBMPATI-UNMCSNQZSA-N |
| XLogP | 4.15 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|