C21H22N2O6S — CID 23864916
[(3R,4R)-4-[(4-cyanophenyl)carbamoyloxy]-4-(4-hydroxyphenyl)-3-methoxybutyl] 2-sulfanylacetate (PubChem CID 23864916) has the molecular formula C21H22N2O6S and a molecular weight of 430.48 g/mol. Its IUPAC name is [(3R,4R)-4-[(4-cyanophenyl)carbamoyloxy]-4-(4-hydroxyphenyl)-3-methoxybutyl] 2-sulfanylacetate.
| Compound Name | [(3R,4R)-4-[(4-cyanophenyl)carbamoyloxy]-4-(4-hydroxyphenyl)-3-methoxybutyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23864916 |
| Molecular Formula | C21H22N2O6S |
| Molecular Weight | 430.48 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | [(3R,4R)-4-[(4-cyanophenyl)carbamoyloxy]-4-(4-hydroxyphenyl)-3-methoxybutyl] 2-sulfanylacetate |
| SMILES | CO[C@H](CCOC(=O)CS)[C@H](OC(=O)Nc1ccc(C#N)cc1)c1ccc(O)cc1 |
| InChI | InChI=1S/C21H22N2O6S/c1-27-18(10-11-28-19(25)13-30)20(15-4-8-17(24)9-5-15)29-21(26)23-16-6-2-14(12-22)3-7-16/h2-9,18,20,24,30H,10-11,13H2,1H3,(H,23,26)/t18-,20-/m1/s1 |
| InChIKey | DMNSIZTVJQSSHZ-UYAOXDASSA-N |
| XLogP | 3.43 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.48 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|