C22H27NO6S — CID 23750212
[(3R,4R)-4-[4-(2-hydroxyethoxy)phenyl]-3-methyl-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate (PubChem CID 23750212) has the molecular formula C22H27NO6S and a molecular weight of 433.53 g/mol. Its IUPAC name is [(3R,4R)-4-[4-(2-hydroxyethoxy)phenyl]-3-methyl-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate.
| Compound Name | [(3R,4R)-4-[4-(2-hydroxyethoxy)phenyl]-3-methyl-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23750212 |
| Molecular Formula | C22H27NO6S |
| Molecular Weight | 433.53 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | [(3R,4R)-4-[4-(2-hydroxyethoxy)phenyl]-3-methyl-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate |
| SMILES | C[C@H](CCOC(=O)CS)[C@@H](OC(=O)Nc1ccccc1)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C22H27NO6S/c1-16(11-13-28-20(25)15-30)21(17-7-9-19(10-8-17)27-14-12-24)29-22(26)23-18-5-3-2-4-6-18/h2-10,16,21,24,30H,11-15H2,1H3,(H,23,26)/t16-,21-/m1/s1 |
| InChIKey | XXNSIYFAUILDOE-IIBYNOLFSA-N |
| XLogP | 3.85 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.53 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|