C21H25NO6S — CID 23807601
[(3R,4S)-4-(3-hydroxy-4-methoxyphenyl)-3-methyl-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate (PubChem CID 23807601) has the molecular formula C21H25NO6S and a molecular weight of 419.50 g/mol. Its IUPAC name is [(3R,4S)-4-(3-hydroxy-4-methoxyphenyl)-3-methyl-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate.
| Compound Name | [(3R,4S)-4-(3-hydroxy-4-methoxyphenyl)-3-methyl-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23807601 |
| Molecular Formula | C21H25NO6S |
| Molecular Weight | 419.50 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | [(3R,4S)-4-(3-hydroxy-4-methoxyphenyl)-3-methyl-4-(phenylcarbamoyloxy)butyl] 2-sulfanylacetate |
| SMILES | COc1ccc([C@@H](OC(=O)Nc2ccccc2)[C@H](C)CCOC(=O)CS)cc1O |
| InChI | InChI=1S/C21H25NO6S/c1-14(10-11-27-19(24)13-29)20(15-8-9-18(26-2)17(23)12-15)28-21(25)22-16-6-4-3-5-7-16/h3-9,12,14,20,23,29H,10-11,13H2,1-2H3,(H,22,25)/t14-,20+/m1/s1 |
| InChIKey | LBIOPQRMECMHOF-VLIAUNLRSA-N |
| XLogP | 4.19 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.50 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|