C22H25NO7 — CID 23892358
(E,6R,7R)-7-(3-hydroxy-4-methoxyphenyl)-6-methoxy-7-(phenylcarbamoyloxy)hept-2-enoic acid (PubChem CID 23892358) has the molecular formula C22H25NO7 and a molecular weight of 415.44 g/mol. Its IUPAC name is (E,6R,7R)-7-(3-hydroxy-4-methoxyphenyl)-6-methoxy-7-(phenylcarbamoyloxy)hept-2-enoic acid.
| Compound Name | (E,6R,7R)-7-(3-hydroxy-4-methoxyphenyl)-6-methoxy-7-(phenylcarbamoyloxy)hept-2-enoic acid |
|---|---|
| PubChem CID | 23892358 |
| Molecular Formula | C22H25NO7 |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | (E,6R,7R)-7-(3-hydroxy-4-methoxyphenyl)-6-methoxy-7-(phenylcarbamoyloxy)hept-2-enoic acid |
| SMILES | COc1ccc([C@@H](OC(=O)Nc2ccccc2)[C@@H](CC/C=C/C(=O)O)OC)cc1O |
| InChI | InChI=1S/C22H25NO7/c1-28-18-13-12-15(14-17(18)24)21(19(29-2)10-6-7-11-20(25)26)30-22(27)23-16-8-4-3-5-9-16/h3-5,7-9,11-14,19,21,24H,6,10H2,1-2H3,(H,23,27)(H,25,26)/b11-7+/t19-,21-/m1/s1 |
| InChIKey | LOZNYIJEVWNAMG-RZPVRENCSA-N |
| XLogP | 4.13 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|