C24H23NO6 — CID 23948258
(E,4S,5S)-5-(3-hydroxy-4-methoxyphenyl)-4-methyl-5-(naphthalen-1-ylcarbamoyloxy)pent-2-enoic acid (PubChem CID 23948258) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is (E,4S,5S)-5-(3-hydroxy-4-methoxyphenyl)-4-methyl-5-(naphthalen-1-ylcarbamoyloxy)pent-2-enoic acid.
| Compound Name | (E,4S,5S)-5-(3-hydroxy-4-methoxyphenyl)-4-methyl-5-(naphthalen-1-ylcarbamoyloxy)pent-2-enoic acid |
|---|---|
| PubChem CID | 23948258 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | (E,4S,5S)-5-(3-hydroxy-4-methoxyphenyl)-4-methyl-5-(naphthalen-1-ylcarbamoyloxy)pent-2-enoic acid |
| SMILES | COc1ccc([C@@H](OC(=O)Nc2cccc3ccccc23)[C@@H](C)/C=C/C(=O)O)cc1O |
| InChI | InChI=1S/C24H23NO6/c1-15(10-13-22(27)28)23(17-11-12-21(30-2)20(26)14-17)31-24(29)25-19-9-5-7-16-6-3-4-8-18(16)19/h3-15,23,26H,1-2H3,(H,25,29)(H,27,28)/b13-10+/t15-,23-/m0/s1 |
| InChIKey | LHIGRJOBKDQUBA-AFSGMLBISA-N |
| XLogP | 5.12 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|