C22H24BrNO6 — CID 23920449
(E,6R,7R)-7-[(4-bromophenyl)carbamoyloxy]-7-(3-hydroxy-4-methoxyphenyl)-6-methylhept-2-enoic acid (PubChem CID 23920449) has the molecular formula C22H24BrNO6 and a molecular weight of 478.34 g/mol. Its IUPAC name is (E,6R,7R)-7-[(4-bromophenyl)carbamoyloxy]-7-(3-hydroxy-4-methoxyphenyl)-6-methylhept-2-enoic acid.
| Compound Name | (E,6R,7R)-7-[(4-bromophenyl)carbamoyloxy]-7-(3-hydroxy-4-methoxyphenyl)-6-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 23920449 |
| Molecular Formula | C22H24BrNO6 |
| Molecular Weight | 478.34 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | (E,6R,7R)-7-[(4-bromophenyl)carbamoyloxy]-7-(3-hydroxy-4-methoxyphenyl)-6-methylhept-2-enoic acid |
| SMILES | COc1ccc([C@H](OC(=O)Nc2ccc(Br)cc2)[C@H](C)CC/C=C/C(=O)O)cc1O |
| InChI | InChI=1S/C22H24BrNO6/c1-14(5-3-4-6-20(26)27)21(15-7-12-19(29-2)18(25)13-15)30-22(28)24-17-10-8-16(23)9-11-17/h4,6-14,21,25H,3,5H2,1-2H3,(H,24,28)(H,26,27)/b6-4+/t14-,21-/m1/s1 |
| InChIKey | SLJBLWPEKORAOB-CALCMETGSA-N |
| XLogP | 5.51 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.34 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|