C29H31N3O6 — CID 23948282
[(E,1R,2R)-7-(2-aminoanilino)-1-(3-hydroxy-4-methoxyphenyl)-2-methyl-7-oxohept-5-enyl] N-benzoylcarbamate (PubChem CID 23948282) has the molecular formula C29H31N3O6 and a molecular weight of 517.58 g/mol. Its IUPAC name is [(E,1R,2R)-7-(2-aminoanilino)-1-(3-hydroxy-4-methoxyphenyl)-2-methyl-7-oxohept-5-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1R,2R)-7-(2-aminoanilino)-1-(3-hydroxy-4-methoxyphenyl)-2-methyl-7-oxohept-5-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23948282 |
| Molecular Formula | C29H31N3O6 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | [(E,1R,2R)-7-(2-aminoanilino)-1-(3-hydroxy-4-methoxyphenyl)-2-methyl-7-oxohept-5-enyl] N-benzoylcarbamate |
| SMILES | COc1ccc([C@H](OC(=O)NC(=O)c2ccccc2)[C@H](C)CC/C=C/C(=O)Nc2ccccc2N)cc1O |
| InChI | InChI=1S/C29H31N3O6/c1-19(10-6-9-15-26(34)31-23-14-8-7-13-22(23)30)27(21-16-17-25(37-2)24(33)18-21)38-29(36)32-28(35)20-11-4-3-5-12-20/h3-5,7-9,11-19,27,33H,6,10,30H2,1-2H3,(H,31,34)(H,32,35,36)/b15-9+/t19-,27-/m1/s1 |
| InChIKey | CRXOKSMXNHOCPJ-CSUATWBCSA-N |
| XLogP | 5.20 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|